C25H26FN5O4 — CID 166469334
3-[6-[2-[3-(5-fluoropyrimidin-2-yl)azetidin-1-yl]cyclopentyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166469334) has the molecular formula C25H26FN5O4 and a molecular weight of 479.51 g/mol. Its IUPAC name is 3-[6-[2-[3-(5-fluoropyrimidin-2-yl)azetidin-1-yl]cyclopentyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[2-[3-(5-fluoropyrimidin-2-yl)azetidin-1-yl]cyclopentyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166469334 |
| Molecular Formula | C25H26FN5O4 |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 3-[6-[2-[3-(5-fluoropyrimidin-2-yl)azetidin-1-yl]cyclopentyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(OC4CCCC4N4CC(c5ncc(F)cn5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H26FN5O4/c26-16-9-27-23(28-10-16)15-11-30(12-15)19-2-1-3-21(19)35-17-4-5-18-14(8-17)13-31(25(18)34)20-6-7-22(32)29-24(20)33/h4-5,8-10,15,19-21H,1-3,6-7,11-13H2,(H,29,32,33) |
| InChIKey | YESNGICPVDOOCG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|