C27H31N5O4 — CID 167302915
3-[6-[(1S)-2-[3-(5-methylpyrimidin-2-yl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167302915) has the molecular formula C27H31N5O4 and a molecular weight of 489.58 g/mol. Its IUPAC name is 3-[6-[(1S)-2-[3-(5-methylpyrimidin-2-yl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(1S)-2-[3-(5-methylpyrimidin-2-yl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167302915 |
| Molecular Formula | C27H31N5O4 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 3-[6-[(1S)-2-[3-(5-methylpyrimidin-2-yl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cc1cnc(C2CN(C3CCCC[C@@H]3Oc3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)C2)nc1 |
| InChI | InChI=1S/C27H31N5O4/c1-16-11-28-25(29-12-16)18-13-31(14-18)21-4-2-3-5-23(21)36-19-6-7-20-17(10-19)15-32(27(20)35)22-8-9-24(33)30-26(22)34/h6-7,10-12,18,21-23H,2-5,8-9,13-15H2,1H3,(H,30,33,34)/t21?,22?,23-/m0/s1 |
| InChIKey | PCZOZZVCTFUHBI-VNXZQDSDSA-N |
| XLogP | 2.34 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|