C29H30F3N3O4 — CID 167307191
3-[3-oxo-6-[(1R,2R)-2-[3-[2-(trifluoromethyl)phenyl]azetidin-1-yl]cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167307191) has the molecular formula C29H30F3N3O4 and a molecular weight of 541.57 g/mol. Its IUPAC name is 3-[3-oxo-6-[(1R,2R)-2-[3-[2-(trifluoromethyl)phenyl]azetidin-1-yl]cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[(1R,2R)-2-[3-[2-(trifluoromethyl)phenyl]azetidin-1-yl]cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167307191 |
| Molecular Formula | C29H30F3N3O4 |
| Molecular Weight | 541.57 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | 3-[3-oxo-6-[(1R,2R)-2-[3-[2-(trifluoromethyl)phenyl]azetidin-1-yl]cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(O[C@@H]4CCCC[C@H]4N4CC(c5ccccc5C(F)(F)F)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H30F3N3O4/c30-29(31,32)22-6-2-1-5-20(22)18-14-34(15-18)23-7-3-4-8-25(23)39-19-9-10-21-17(13-19)16-35(28(21)38)24-11-12-26(36)33-27(24)37/h1-2,5-6,9-10,13,18,23-25H,3-4,7-8,11-12,14-16H2,(H,33,36,37)/t23-,24?,25-/m1/s1 |
| InChIKey | ADTJOHKRUYWZNE-VSPQQOHGSA-N |
| XLogP | 4.26 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|