C29H30F3N3O5 — CID 166469045
3-[3-oxo-6-[(1S,2S)-2-[3-[4-(trifluoromethoxy)phenyl]azetidin-1-yl]cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166469045) has the molecular formula C29H30F3N3O5 and a molecular weight of 557.57 g/mol. Its IUPAC name is 3-[3-oxo-6-[(1S,2S)-2-[3-[4-(trifluoromethoxy)phenyl]azetidin-1-yl]cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[(1S,2S)-2-[3-[4-(trifluoromethoxy)phenyl]azetidin-1-yl]cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166469045 |
| Molecular Formula | C29H30F3N3O5 |
| Molecular Weight | 557.57 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | 3-[3-oxo-6-[(1S,2S)-2-[3-[4-(trifluoromethoxy)phenyl]azetidin-1-yl]cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(O[C@H]4CCCC[C@@H]4N4CC(c5ccc(OC(F)(F)F)cc5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H30F3N3O5/c30-29(31,32)40-20-7-5-17(6-8-20)19-14-34(15-19)23-3-1-2-4-25(23)39-21-9-10-22-18(13-21)16-35(28(22)38)24-11-12-26(36)33-27(24)37/h5-10,13,19,23-25H,1-4,11-12,14-16H2,(H,33,36,37)/t23-,24?,25-/m0/s1 |
| InChIKey | KACCHMVEEUHVIP-PFIFLBKHSA-N |
| XLogP | 4.14 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|