C14H11N3O3 — CID 156628917
3-(6-(114C)methylidyneazaniumyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (PubChem CID 156628917) has the molecular formula C14H11N3O3 and a molecular weight of 271.25 g/mol. Its IUPAC name is 3-(6-(114C)methylidyneazaniumyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(6-(114C)methylidyneazaniumyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 156628917 |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3-(6-(114C)methylidyneazaniumyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| SMILES | [14C-]#[N+]c1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C14H11N3O3/c1-15-9-2-3-10-8(6-9)7-17(14(10)20)11-4-5-12(18)16-13(11)19/h2-3,6,11H,4-5,7H2,(H,16,18,19)/i1+2 |
| InChIKey | DYKNZKXNSMCLNY-NJFSPNSNSA-N |
| XLogP | 1.00 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|