C25H25FN6O3 — CID 169309553
3-[5-fluoro-3-oxo-6-[4-(pyrazolo[1,5-a]pyridin-7-ylmethyl)piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169309553) has the molecular formula C25H25FN6O3 and a molecular weight of 476.51 g/mol. Its IUPAC name is 3-[5-fluoro-3-oxo-6-[4-(pyrazolo[1,5-a]pyridin-7-ylmethyl)piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-3-oxo-6-[4-(pyrazolo[1,5-a]pyridin-7-ylmethyl)piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169309553 |
| Molecular Formula | C25H25FN6O3 |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 3-[5-fluoro-3-oxo-6-[4-(pyrazolo[1,5-a]pyridin-7-ylmethyl)piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(N4CCN(Cc5cccc6ccnn56)CC4)c(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H25FN6O3/c26-20-13-19-16(14-31(25(19)35)21-4-5-23(33)28-24(21)34)12-22(20)30-10-8-29(9-11-30)15-18-3-1-2-17-6-7-27-32(17)18/h1-3,6-7,12-13,21H,4-5,8-11,14-15H2,(H,28,33,34) |
| InChIKey | YOOBTGTVEVWXTH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 90.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|