C31H29FN4O6 — CID 171829268
3-[6-[4-[bis(4-hydroxyphenyl)methyl]piperazine-1-carbonyl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171829268) has the molecular formula C31H29FN4O6 and a molecular weight of 572.59 g/mol. Its IUPAC name is 3-[6-[4-[bis(4-hydroxyphenyl)methyl]piperazine-1-carbonyl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[bis(4-hydroxyphenyl)methyl]piperazine-1-carbonyl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171829268 |
| Molecular Formula | C31H29FN4O6 |
| Molecular Weight | 572.59 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | 3-[6-[4-[bis(4-hydroxyphenyl)methyl]piperazine-1-carbonyl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(ccc(C(=O)N4CCN(C(c5ccc(O)cc5)c5ccc(O)cc5)CC4)c3F)C2=O)C(=O)N1 |
| InChI | InChI=1S/C31H29FN4O6/c32-27-23(10-9-22-24(27)17-36(31(22)42)25-11-12-26(39)33-29(25)40)30(41)35-15-13-34(14-16-35)28(18-1-5-20(37)6-2-18)19-3-7-21(38)8-4-19/h1-10,25,28,37-38H,11-17H2,(H,33,39,40) |
| InChIKey | GFHMYELQBLIUPL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 130.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.59 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|