C15H13FN2O5 — CID 176908233
2-[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]acetic acid (PubChem CID 176908233) has the molecular formula C15H13FN2O5 and a molecular weight of 320.28 g/mol. Its IUPAC name is 2-[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]acetic acid.
| Compound Name | 2-[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]acetic acid |
|---|---|
| PubChem CID | 176908233 |
| Molecular Formula | C15H13FN2O5 |
| Molecular Weight | 320.28 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]acetic acid |
| SMILES | O=C(O)Cc1ccc2c(c1F)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C15H13FN2O5/c16-13-7(5-12(20)21)1-2-8-9(13)6-18(15(8)23)10-3-4-11(19)17-14(10)22/h1-2,10H,3-6H2,(H,20,21)(H,17,19,22) |
| InChIKey | VWAPNKYURYYNDB-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|