C27H18FN3O7 — CID 168872213
N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]methyl]-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide (PubChem CID 168872213) has the molecular formula C27H18FN3O7 and a molecular weight of 515.45 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]methyl]-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]methyl]-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 168872213 |
| Molecular Formula | C27H18FN3O7 |
| Molecular Weight | 515.45 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]methyl]-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide |
| SMILES | O=C1CCC(N2Cc3c(ccc(CNC(=O)c4cc5c(o4)C(=O)c4ccccc4C5=O)c3F)C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H18FN3O7/c28-21-12(5-6-15-17(21)11-31(27(15)37)18-7-8-20(32)30-25(18)35)10-29-26(36)19-9-16-22(33)13-3-1-2-4-14(13)23(34)24(16)38-19/h1-6,9,18H,7-8,10-11H2,(H,29,36)(H,30,32,35) |
| InChIKey | UDIXZHWIVNJGEV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 142.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|