C23H22FN3O6 — CID 177262422
N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]methyl]-3,4-dimethoxybenzamide (PubChem CID 177262422) has the molecular formula C23H22FN3O6 and a molecular weight of 455.44 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]methyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]methyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 177262422 |
| Molecular Formula | C23H22FN3O6 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]methyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCc2ccc3c(c2F)CN(C2CCC(=O)NC2=O)C3=O)cc1OC |
| InChI | InChI=1S/C23H22FN3O6/c1-32-17-7-4-12(9-18(17)33-2)21(29)25-10-13-3-5-14-15(20(13)24)11-27(23(14)31)16-6-8-19(28)26-22(16)30/h3-5,7,9,16H,6,8,10-11H2,1-2H3,(H,25,29)(H,26,28,30) |
| InChIKey | WVLUZJDGGFVLCY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|