C24H22FN3O4 — CID 177262442
4-cyclopropyl-N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]methyl]benzamide (PubChem CID 177262442) has the molecular formula C24H22FN3O4 and a molecular weight of 435.46 g/mol. Its IUPAC name is 4-cyclopropyl-N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]methyl]benzamide.
| Compound Name | 4-cyclopropyl-N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 177262442 |
| Molecular Formula | C24H22FN3O4 |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 4-cyclopropyl-N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]methyl]benzamide |
| SMILES | O=C1CCC(N2Cc3c(ccc(CNC(=O)c4ccc(C5CC5)cc4)c3F)C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H22FN3O4/c25-21-16(11-26-22(30)15-5-3-14(4-6-15)13-1-2-13)7-8-17-18(21)12-28(24(17)32)19-9-10-20(29)27-23(19)31/h3-8,13,19H,1-2,9-12H2,(H,26,30)(H,27,29,31) |
| InChIKey | CAVWLFLDTLEMNJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|