C21H17ClFN3O4 — CID 177262387
4-chloro-N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]methyl]benzamide (PubChem CID 177262387) has the molecular formula C21H17ClFN3O4 and a molecular weight of 429.84 g/mol. Its IUPAC name is 4-chloro-N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]methyl]benzamide.
| Compound Name | 4-chloro-N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 177262387 |
| Molecular Formula | C21H17ClFN3O4 |
| Molecular Weight | 429.84 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 4-chloro-N-[[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]methyl]benzamide |
| SMILES | O=C1CCC(N2Cc3c(ccc(CNC(=O)c4ccc(Cl)cc4)c3F)C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H17ClFN3O4/c22-13-4-1-11(2-5-13)19(28)24-9-12-3-6-14-15(18(12)23)10-26(21(14)30)16-7-8-17(27)25-20(16)29/h1-6,16H,7-10H2,(H,24,28)(H,25,27,29) |
| InChIKey | ONOCOQFYZKCXAU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.84 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|