C26H20N4O7 — CID 164592055
N-[5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]penta-2,4-diynyl]-3-methoxy-4-nitrobenzamide (PubChem CID 164592055) has the molecular formula C26H20N4O7 and a molecular weight of 500.47 g/mol. Its IUPAC name is N-[5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]penta-2,4-diynyl]-3-methoxy-4-nitrobenzamide.
| Compound Name | N-[5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]penta-2,4-diynyl]-3-methoxy-4-nitrobenzamide |
|---|---|
| PubChem CID | 164592055 |
| Molecular Formula | C26H20N4O7 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | N-[5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]penta-2,4-diynyl]-3-methoxy-4-nitrobenzamide |
| SMILES | COc1cc(C(=O)NCC#CC#Cc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H20N4O7/c1-37-22-14-17(9-10-20(22)30(35)36)24(32)27-13-4-2-3-6-16-7-5-8-18-19(16)15-29(26(18)34)21-11-12-23(31)28-25(21)33/h5,7-10,14,21H,11-13,15H2,1H3,(H,27,32)(H,28,31,33) |
| InChIKey | LZILMLBUFTZNLB-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|