C40H31N5O7 — CID 168863724
N-[5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]pent-4-ynyl]-4-[2-(furan-2-yl)-6-(4-nitrophenyl)-4-pyridinyl]benzamide (PubChem CID 168863724) has the molecular formula C40H31N5O7 and a molecular weight of 693.72 g/mol. Its IUPAC name is N-[5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]pent-4-ynyl]-4-[2-(furan-2-yl)-6-(4-nitrophenyl)-4-pyridinyl]benzamide.
| Compound Name | N-[5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]pent-4-ynyl]-4-[2-(furan-2-yl)-6-(4-nitrophenyl)-4-pyridinyl]benzamide |
|---|---|
| PubChem CID | 168863724 |
| Molecular Formula | C40H31N5O7 |
| Molecular Weight | 693.72 g/mol |
| Exact Mass | 693.22 |
| IUPAC Name | N-[5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]pent-4-ynyl]-4-[2-(furan-2-yl)-6-(4-nitrophenyl)-4-pyridinyl]benzamide |
| SMILES | O=C1CCC(N2Cc3c(C#CCCCNC(=O)c4ccc(-c5cc(-c6ccc([N+](=O)[O-])cc6)nc(-c6ccco6)c5)cc4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C40H31N5O7/c46-37-19-18-35(39(48)43-37)44-24-32-26(7-4-8-31(32)40(44)49)6-2-1-3-20-41-38(47)28-12-10-25(11-13-28)29-22-33(27-14-16-30(17-15-27)45(50)51)42-34(23-29)36-9-5-21-52-36/h4-5,7-17,21-23,35H,1,3,18-20,24H2,(H,41,47)(H,43,46,48) |
| InChIKey | BEGWVETVIHKNLL-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.72 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|