C43H39N5O8 — CID 168863619
N-[8-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]octyl]-4-[2-(furan-2-yl)-6-(4-nitrophenyl)-4-pyridinyl]benzamide (PubChem CID 168863619) has the molecular formula C43H39N5O8 and a molecular weight of 753.81 g/mol. Its IUPAC name is N-[8-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]octyl]-4-[2-(furan-2-yl)-6-(4-nitrophenyl)-4-pyridinyl]benzamide.
| Compound Name | N-[8-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]octyl]-4-[2-(furan-2-yl)-6-(4-nitrophenyl)-4-pyridinyl]benzamide |
|---|---|
| PubChem CID | 168863619 |
| Molecular Formula | C43H39N5O8 |
| Molecular Weight | 753.81 g/mol |
| Exact Mass | 753.28 |
| IUPAC Name | N-[8-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]octyl]-4-[2-(furan-2-yl)-6-(4-nitrophenyl)-4-pyridinyl]benzamide |
| SMILES | O=C1CCC(N2C(=O)c3ccc(CCCCCCCCNC(=O)c4ccc(-c5cc(-c6ccc([N+](=O)[O-])cc6)nc(-c6ccco6)c5)cc4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C43H39N5O8/c49-39-21-20-37(41(51)46-39)47-42(52)33-19-10-27(24-34(33)43(47)53)8-5-3-1-2-4-6-22-44-40(50)30-13-11-28(12-14-30)31-25-35(29-15-17-32(18-16-29)48(54)55)45-36(26-31)38-9-7-23-56-38/h7,9-19,23-26,37H,1-6,8,20-22H2,(H,44,50)(H,46,49,51) |
| InChIKey | QWEAIHKJHVVZSH-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.81 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|