C39H32N4O9 — CID 168863587
4-[2-[4-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethoxy]ethoxy]phenyl]-6-(furan-2-yl)-4-pyridinyl]benzamide (PubChem CID 168863587) has the molecular formula C39H32N4O9 and a molecular weight of 700.70 g/mol. Its IUPAC name is 4-[2-[4-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethoxy]ethoxy]phenyl]-6-(furan-2-yl)-4-pyridinyl]benzamide.
| Compound Name | 4-[2-[4-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethoxy]ethoxy]phenyl]-6-(furan-2-yl)-4-pyridinyl]benzamide |
|---|---|
| PubChem CID | 168863587 |
| Molecular Formula | C39H32N4O9 |
| Molecular Weight | 700.70 g/mol |
| Exact Mass | 700.22 |
| IUPAC Name | 4-[2-[4-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethoxy]ethoxy]phenyl]-6-(furan-2-yl)-4-pyridinyl]benzamide |
| SMILES | NC(=O)c1ccc(-c2cc(-c3ccc(OCCOCCOc4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5=O)cc3)nc(-c3ccco3)c2)cc1 |
| InChI | InChI=1S/C39H32N4O9/c40-36(45)25-5-3-23(4-6-25)26-20-31(41-32(21-26)34-2-1-15-52-34)24-7-9-27(10-8-24)50-18-16-49-17-19-51-28-11-12-29-30(22-28)39(48)43(38(29)47)33-13-14-35(44)42-37(33)46/h1-12,15,20-22,33H,13-14,16-19H2,(H2,40,45)(H,42,44,46) |
| InChIKey | KBBHBOULEUCPDZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 180.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.70 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|