C41H37N5O9 — CID 168863692
4-[2-[4-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]phenyl]-6-(furan-2-yl)-4-pyridinyl]benzamide (PubChem CID 168863692) has the molecular formula C41H37N5O9 and a molecular weight of 743.77 g/mol. Its IUPAC name is 4-[2-[4-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]phenyl]-6-(furan-2-yl)-4-pyridinyl]benzamide.
| Compound Name | 4-[2-[4-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]phenyl]-6-(furan-2-yl)-4-pyridinyl]benzamide |
|---|---|
| PubChem CID | 168863692 |
| Molecular Formula | C41H37N5O9 |
| Molecular Weight | 743.77 g/mol |
| Exact Mass | 743.26 |
| IUPAC Name | 4-[2-[4-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]phenyl]-6-(furan-2-yl)-4-pyridinyl]benzamide |
| SMILES | NC(=O)c1ccc(-c2cc(-c3ccc(OCCOCCOCCNc4cccc5c4C(=O)N(C4CCC(=O)NC4=O)C5=O)cc3)nc(-c3ccco3)c2)cc1 |
| InChI | InChI=1S/C41H37N5O9/c42-38(48)27-8-6-25(7-9-27)28-23-32(44-33(24-28)35-5-2-17-55-35)26-10-12-29(13-11-26)54-22-21-53-20-19-52-18-16-43-31-4-1-3-30-37(31)41(51)46(40(30)50)34-14-15-36(47)45-39(34)49/h1-13,17,23-24,34,43H,14-16,18-22H2,(H2,42,48)(H,45,47,49) |
| InChIKey | ONQOYUJGIDMVBR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 192.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.77 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|