C25H29N7O10 — CID 138696083
1-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethyl]-4-nitropyrazole-3-carboxamide (PubChem CID 138696083) has the molecular formula C25H29N7O10 and a molecular weight of 587.55 g/mol. Its IUPAC name is 1-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethyl]-4-nitropyrazole-3-carboxamide.
| Compound Name | 1-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethyl]-4-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 138696083 |
| Molecular Formula | C25H29N7O10 |
| Molecular Weight | 587.55 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | 1-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethyl]-4-nitropyrazole-3-carboxamide |
| SMILES | NC(=O)c1nn(CCOCCOCCOCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H29N7O10/c26-22(34)21-18(32(38)39)14-30(29-21)7-9-41-11-13-42-12-10-40-8-6-27-16-3-1-2-15-20(16)25(37)31(24(15)36)17-4-5-19(33)28-23(17)35/h1-3,14,17,27H,4-13H2,(H2,26,34)(H,28,33,35) |
| InChIKey | WNKOJGYNFRRBLW-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 227.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.55 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|