C22H26N6O6 — CID 170777475
2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-(4-methyltriazol-1-yl)ethoxy]ethoxy]ethylamino]isoindole-1,3-dione (PubChem CID 170777475) has the molecular formula C22H26N6O6 and a molecular weight of 470.49 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-(4-methyltriazol-1-yl)ethoxy]ethoxy]ethylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-(4-methyltriazol-1-yl)ethoxy]ethoxy]ethylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 170777475 |
| Molecular Formula | C22H26N6O6 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-(4-methyltriazol-1-yl)ethoxy]ethoxy]ethylamino]isoindole-1,3-dione |
| SMILES | Cc1cn(CCOCCOCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)nn1 |
| InChI | InChI=1S/C22H26N6O6/c1-14-13-27(26-25-14)8-10-34-12-11-33-9-7-23-16-4-2-3-15-19(16)22(32)28(21(15)31)17-5-6-18(29)24-20(17)30/h2-4,13,17,23H,5-12H2,1H3,(H,24,29,30) |
| InChIKey | GWITUNYSLSHKJI-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 144.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|