C24H28N6O9 — CID 138695641
2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-[2-(4-nitropyrazol-1-yl)ethoxy]ethoxy]ethoxy]ethylamino]isoindole-1,3-dione (PubChem CID 138695641) has the molecular formula C24H28N6O9 and a molecular weight of 544.52 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-[2-(4-nitropyrazol-1-yl)ethoxy]ethoxy]ethoxy]ethylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-[2-(4-nitropyrazol-1-yl)ethoxy]ethoxy]ethoxy]ethylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 138695641 |
| Molecular Formula | C24H28N6O9 |
| Molecular Weight | 544.52 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-[2-(4-nitropyrazol-1-yl)ethoxy]ethoxy]ethoxy]ethylamino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCOCCOCCOCCn4cc([N+](=O)[O-])cn4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H28N6O9/c31-20-5-4-19(22(32)27-20)29-23(33)17-2-1-3-18(21(17)24(29)34)25-6-8-37-10-12-39-13-11-38-9-7-28-15-16(14-26-28)30(35)36/h1-3,14-15,19,25H,4-13H2,(H,27,31,32) |
| InChIKey | JHVTUVPTXQLZML-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 184.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.52 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|