C22H21N5O5 — CID 134352509
2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-(4-ethynylpyrazol-1-yl)ethoxy]ethylamino]isoindole-1,3-dione (PubChem CID 134352509) has the molecular formula C22H21N5O5 and a molecular weight of 435.44 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-(4-ethynylpyrazol-1-yl)ethoxy]ethylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-(4-ethynylpyrazol-1-yl)ethoxy]ethylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134352509 |
| Molecular Formula | C22H21N5O5 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-(4-ethynylpyrazol-1-yl)ethoxy]ethylamino]isoindole-1,3-dione |
| SMILES | C#Cc1cnn(CCOCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)c1 |
| InChI | InChI=1S/C22H21N5O5/c1-2-14-12-24-26(13-14)9-11-32-10-8-23-16-5-3-4-15-19(16)22(31)27(21(15)30)17-6-7-18(28)25-20(17)29/h1,3-5,12-13,17,23H,6-11H2,(H,25,28,29) |
| InChIKey | UBJKETISFIWWIQ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|