C22H27N7O6 — CID 138695835
4-[[1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]triazol-4-yl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 138695835) has the molecular formula C22H27N7O6 and a molecular weight of 485.50 g/mol. Its IUPAC name is 4-[[1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]triazol-4-yl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]triazol-4-yl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 138695835 |
| Molecular Formula | C22H27N7O6 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 4-[[1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]triazol-4-yl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | NCCOCCOCCn1cc(CNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)nn1 |
| InChI | InChI=1S/C22H27N7O6/c23-6-8-34-10-11-35-9-7-28-13-14(26-27-28)12-24-16-3-1-2-15-19(16)22(33)29(21(15)32)17-4-5-18(30)25-20(17)31/h1-3,13,17,24H,4-12,23H2,(H,25,30,31) |
| InChIKey | GXVUYIATICSLKD-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 170.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|