C46H37N7O9 — CID 168863668
N-[4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butylcarbamoyl]phenyl]-4-[2-(furan-2-yl)-6-(4-nitrophenyl)-4-pyridinyl]benzamide (PubChem CID 168863668) has the molecular formula C46H37N7O9 and a molecular weight of 831.84 g/mol. Its IUPAC name is N-[4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butylcarbamoyl]phenyl]-4-[2-(furan-2-yl)-6-(4-nitrophenyl)-4-pyridinyl]benzamide.
| Compound Name | N-[4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butylcarbamoyl]phenyl]-4-[2-(furan-2-yl)-6-(4-nitrophenyl)-4-pyridinyl]benzamide |
|---|---|
| PubChem CID | 168863668 |
| Molecular Formula | C46H37N7O9 |
| Molecular Weight | 831.84 g/mol |
| Exact Mass | 831.27 |
| IUPAC Name | N-[4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butylcarbamoyl]phenyl]-4-[2-(furan-2-yl)-6-(4-nitrophenyl)-4-pyridinyl]benzamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCCCNC(=O)c4ccc(NC(=O)c5ccc(-c6cc(-c7ccc([N+](=O)[O-])cc7)nc(-c7ccco7)c6)cc5)cc4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C46H37N7O9/c54-40-21-20-38(44(57)51-40)52-45(58)34-5-3-6-35(41(34)46(52)59)47-22-1-2-23-48-42(55)29-12-16-32(17-13-29)49-43(56)30-10-8-27(9-11-30)31-25-36(28-14-18-33(19-15-28)53(60)61)50-37(26-31)39-7-4-24-62-39/h3-19,24-26,38,47H,1-2,20-23H2,(H,48,55)(H,49,56)(H,51,54,57) |
| InChIKey | WWRCKMYKGWDRGZ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 222.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.84 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|