C46H44N6O9 — CID 168863626
2-(2,6-dioxopiperidin-3-yl)-N-[10-[[4-[2-(furan-2-yl)-6-(4-nitrophenyl)-4-pyridinyl]benzoyl]amino]decyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 168863626) has the molecular formula C46H44N6O9 and a molecular weight of 824.89 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-N-[10-[[4-[2-(furan-2-yl)-6-(4-nitrophenyl)-4-pyridinyl]benzoyl]amino]decyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-N-[10-[[4-[2-(furan-2-yl)-6-(4-nitrophenyl)-4-pyridinyl]benzoyl]amino]decyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 168863626 |
| Molecular Formula | C46H44N6O9 |
| Molecular Weight | 824.89 g/mol |
| Exact Mass | 824.32 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-N-[10-[[4-[2-(furan-2-yl)-6-(4-nitrophenyl)-4-pyridinyl]benzoyl]amino]decyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C1CCC(N2C(=O)c3ccc(C(=O)NCCCCCCCCCCNC(=O)c4ccc(-c5cc(-c6ccc([N+](=O)[O-])cc6)nc(-c6ccco6)c5)cc4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C46H44N6O9/c53-41-22-21-39(44(56)50-41)51-45(57)35-20-17-32(26-36(35)46(51)58)43(55)48-24-8-6-4-2-1-3-5-7-23-47-42(54)31-13-11-29(12-14-31)33-27-37(30-15-18-34(19-16-30)52(59)60)49-38(28-33)40-10-9-25-61-40/h9-20,25-28,39H,1-8,21-24H2,(H,47,54)(H,48,55)(H,50,53,56) |
| InChIKey | KYELCJGJDRVKRH-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 210.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.89 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|