C32H27BrN4O6 — CID 156633445
4-[2-[2-[4-(6-bromoquinolin-4-yl)phenoxy]ethoxy]ethylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 156633445) has the molecular formula C32H27BrN4O6 and a molecular weight of 643.49 g/mol. Its IUPAC name is 4-[2-[2-[4-(6-bromoquinolin-4-yl)phenoxy]ethoxy]ethylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[2-[2-[4-(6-bromoquinolin-4-yl)phenoxy]ethoxy]ethylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 156633445 |
| Molecular Formula | C32H27BrN4O6 |
| Molecular Weight | 643.49 g/mol |
| Exact Mass | 642.11 |
| IUPAC Name | 4-[2-[2-[4-(6-bromoquinolin-4-yl)phenoxy]ethoxy]ethylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCOCCOc4ccc(-c5ccnc6ccc(Br)cc56)cc4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C32H27BrN4O6/c33-20-6-9-25-24(18-20)22(12-13-34-25)19-4-7-21(8-5-19)43-17-16-42-15-14-35-26-3-1-2-23-29(26)32(41)37(31(23)40)27-10-11-28(38)36-30(27)39/h1-9,12-13,18,27,35H,10-11,14-17H2,(H,36,38,39) |
| InChIKey | OSYRZPZUJZHECR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|