C27H30N2O7 — CID 134492748
2-(2,6-dioxopiperidin-3-yl)-5-[5-(2-phenylmethoxyethoxy)pentoxy]isoindole-1,3-dione (PubChem CID 134492748) has the molecular formula C27H30N2O7 and a molecular weight of 494.54 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[5-(2-phenylmethoxyethoxy)pentoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[5-(2-phenylmethoxyethoxy)pentoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134492748 |
| Molecular Formula | C27H30N2O7 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[5-(2-phenylmethoxyethoxy)pentoxy]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(OCCCCCOCCOCc4ccccc4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H30N2O7/c30-24-12-11-23(25(31)28-24)29-26(32)21-10-9-20(17-22(21)27(29)33)36-14-6-2-5-13-34-15-16-35-18-19-7-3-1-4-8-19/h1,3-4,7-10,17,23H,2,5-6,11-16,18H2,(H,28,30,31) |
| InChIKey | MNMUVQBPFOGAMM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|