C24H29N3O7 — CID 134492831
4-[5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxypentoxy]piperidine-1-carbaldehyde (PubChem CID 134492831) has the molecular formula C24H29N3O7 and a molecular weight of 471.51 g/mol. Its IUPAC name is 4-[5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxypentoxy]piperidine-1-carbaldehyde.
| Compound Name | 4-[5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxypentoxy]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 134492831 |
| Molecular Formula | C24H29N3O7 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 4-[5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxypentoxy]piperidine-1-carbaldehyde |
| SMILES | O=CN1CCC(OCCCCCOc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C24H29N3O7/c28-15-26-10-8-16(9-11-26)33-12-2-1-3-13-34-17-4-5-18-19(14-17)24(32)27(23(18)31)20-6-7-21(29)25-22(20)30/h4-5,14-16,20H,1-3,6-13H2,(H,25,29,30) |
| InChIKey | QCMKHSGJHILHIL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|