C22H20N2O5 — CID 146411095
2-(2,6-dioxopiperidin-3-yl)-5-(2-phenylmethoxyethyl)isoindole-1,3-dione (PubChem CID 146411095) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-(2-phenylmethoxyethyl)isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-(2-phenylmethoxyethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 146411095 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-(2-phenylmethoxyethyl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(CCOCc4ccccc4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H20N2O5/c25-19-9-8-18(20(26)23-19)24-21(27)16-7-6-14(12-17(16)22(24)28)10-11-29-13-15-4-2-1-3-5-15/h1-7,12,18H,8-11,13H2,(H,23,25,26) |
| InChIKey | XLHIAMUBWSRHDL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|