C15H11F3N2O7S — CID 168872038
[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl trifluoromethanesulfonate (PubChem CID 168872038) has the molecular formula C15H11F3N2O7S and a molecular weight of 420.32 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl trifluoromethanesulfonate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 168872038 |
| Molecular Formula | C15H11F3N2O7S |
| Molecular Weight | 420.32 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl trifluoromethanesulfonate |
| SMILES | O=C1CCC(N2C(=O)c3ccc(COS(=O)(=O)C(F)(F)F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C15H11F3N2O7S/c16-15(17,18)28(25,26)27-6-7-1-2-8-9(5-7)14(24)20(13(8)23)10-3-4-11(21)19-12(10)22/h1-2,5,10H,3-4,6H2,(H,19,21,22) |
| InChIKey | XWFMGLUFGAMGAZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|