C15H11F3N2O6 — CID 175762489
2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;2,2,2-trifluoroacetic acid (PubChem CID 175762489) has the molecular formula C15H11F3N2O6 and a molecular weight of 372.26 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175762489 |
| Molecular Formula | C15H11F3N2O6 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1CCC(N2C(=O)c3ccccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C13H10N2O4.C2HF3O2/c16-10-6-5-9(11(17)14-10)15-12(18)7-3-1-2-4-8(7)13(15)19;3-2(4,5)1(6)7/h1-4,9H,5-6H2,(H,14,16,17);(H,6,7) |
| InChIKey | JNFZWEJFFWDYKF-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|