C22H23F3N4O7 — CID 175762518
4-[2-(2,6-diazaspiro[3.3]heptan-2-yl)ethoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;2,2,2-trifluoroacetic acid (PubChem CID 175762518) has the molecular formula C22H23F3N4O7 and a molecular weight of 512.44 g/mol. Its IUPAC name is 4-[2-(2,6-diazaspiro[3.3]heptan-2-yl)ethoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[2-(2,6-diazaspiro[3.3]heptan-2-yl)ethoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175762518 |
| Molecular Formula | C22H23F3N4O7 |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 4-[2-(2,6-diazaspiro[3.3]heptan-2-yl)ethoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1CCC(N2C(=O)c3cccc(OCCN4CC5(CNC5)C4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H22N4O5.C2HF3O2/c25-15-5-4-13(17(26)22-15)24-18(27)12-2-1-3-14(16(12)19(24)28)29-7-6-23-10-20(11-23)8-21-9-20;3-2(4,5)1(6)7/h1-3,13,21H,4-11H2,(H,22,25,26);(H,6,7) |
| InChIKey | GHIZEBVKBYGFLR-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|