C17H16N2O9 — CID 175921320
2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;(2S)-2-hydroxybutanedioic acid (PubChem CID 175921320) has the molecular formula C17H16N2O9 and a molecular weight of 392.32 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;(2S)-2-hydroxybutanedioic acid.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;(2S)-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 175921320 |
| Molecular Formula | C17H16N2O9 |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;(2S)-2-hydroxybutanedioic acid |
| SMILES | O=C(O)C[C@H](O)C(=O)O.O=C1CCC(N2C(=O)c3ccccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C13H10N2O4.C4H6O5/c16-10-6-5-9(11(17)14-10)15-12(18)7-3-1-2-4-8(7)13(15)19;5-2(4(8)9)1-3(6)7/h1-4,9H,5-6H2,(H,14,16,17);2,5H,1H2,(H,6,7)(H,8,9)/t;2-/m.0/s1 |
| InChIKey | KPNSLHZFLCTRAZ-WNQIDUERSA-N |
| XLogP | -1.01 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|