C18H18N4O7 — CID 166426172
(2R)-2-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetyl]amino]propanoic acid (PubChem CID 166426172) has the molecular formula C18H18N4O7 and a molecular weight of 402.36 g/mol. Its IUPAC name is (2R)-2-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 166426172 |
| Molecular Formula | C18H18N4O7 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | (2R)-2-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetyl]amino]propanoic acid |
| SMILES | C[C@@H](NC(=O)CNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)C(=O)O |
| InChI | InChI=1S/C18H18N4O7/c1-8(18(28)29)20-13(24)7-19-10-4-2-3-9-14(10)17(27)22(16(9)26)11-5-6-12(23)21-15(11)25/h2-4,8,11,19H,5-7H2,1H3,(H,20,24)(H,28,29)(H,21,23,25)/t8-,11?/m1/s1 |
| InChIKey | YQMRFZGSZZJQET-RZZZFEHKSA-N |
| XLogP | -0.91 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|