C23H18N4O6 — CID 166426233
N-(1-benzofuran-4-yl)-2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetamide (PubChem CID 166426233) has the molecular formula C23H18N4O6 and a molecular weight of 446.42 g/mol. Its IUPAC name is N-(1-benzofuran-4-yl)-2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetamide.
| Compound Name | N-(1-benzofuran-4-yl)-2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetamide |
|---|---|
| PubChem CID | 166426233 |
| Molecular Formula | C23H18N4O6 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | N-(1-benzofuran-4-yl)-2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCC(=O)Nc4cccc5occc45)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H18N4O6/c28-18-8-7-16(21(30)26-18)27-22(31)13-3-1-5-15(20(13)23(27)32)24-11-19(29)25-14-4-2-6-17-12(14)9-10-33-17/h1-6,9-10,16,24H,7-8,11H2,(H,25,29)(H,26,28,30) |
| InChIKey | RREOGQVZVQFCSQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|