C26H23N5O9 — CID 129116520
(4S)-5-amino-4-(1,3-dioxoisoindol-2-yl)-5-oxopentanoic acid;4-amino-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 129116520) has the molecular formula C26H23N5O9 and a molecular weight of 549.50 g/mol. Its IUPAC name is (4S)-5-amino-4-(1,3-dioxoisoindol-2-yl)-5-oxopentanoic acid;4-amino-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | (4S)-5-amino-4-(1,3-dioxoisoindol-2-yl)-5-oxopentanoic acid;4-amino-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 129116520 |
| Molecular Formula | C26H23N5O9 |
| Molecular Weight | 549.50 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | (4S)-5-amino-4-(1,3-dioxoisoindol-2-yl)-5-oxopentanoic acid;4-amino-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | NC(=O)[C@H](CCC(=O)O)N1C(=O)c2ccccc2C1=O.Nc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C13H11N3O4.C13H12N2O5/c14-7-3-1-2-6-10(7)13(20)16(12(6)19)8-4-5-9(17)15-11(8)18;14-11(18)9(5-6-10(16)17)15-12(19)7-3-1-2-4-8(7)13(15)20/h1-3,8H,4-5,14H2,(H,15,17,18);1-4,9H,5-6H2,(H2,14,18)(H,16,17)/t;9-/m.0/s1 |
| InChIKey | YPYRQGYKCYPZQN-NPULLEENSA-N |
| XLogP | -0.33 |
| TPSA | 227.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.50 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|