C15H13F3N2O6S — CID 168872676
[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl trifluoromethanesulfonate (PubChem CID 168872676) has the molecular formula C15H13F3N2O6S and a molecular weight of 406.34 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl trifluoromethanesulfonate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 168872676 |
| Molecular Formula | C15H13F3N2O6S |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl trifluoromethanesulfonate |
| SMILES | O=C1CCC(N2Cc3cc(COS(=O)(=O)C(F)(F)F)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C15H13F3N2O6S/c16-15(17,18)27(24,25)26-7-8-1-2-10-9(5-8)6-20(14(10)23)11-3-4-12(21)19-13(11)22/h1-2,5,11H,3-4,6-7H2,(H,19,21,22) |
| InChIKey | FHCWFTRKKCSNSF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|