C15H19N3O6S — CID 86630765
3-[6-(aminomethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;methanesulfonic acid (PubChem CID 86630765) has the molecular formula C15H19N3O6S and a molecular weight of 369.40 g/mol. Its IUPAC name is 3-[6-(aminomethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;methanesulfonic acid.
| Compound Name | 3-[6-(aminomethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;methanesulfonic acid |
|---|---|
| PubChem CID | 86630765 |
| Molecular Formula | C15H19N3O6S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 3-[6-(aminomethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.NCc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C14H15N3O3.CH4O3S/c15-6-8-1-2-10-9(5-8)7-17(14(10)20)11-3-4-12(18)16-13(11)19;1-5(2,3)4/h1-2,5,11H,3-4,6-7,15H2,(H,16,18,19);1H3,(H,2,3,4) |
| InChIKey | SUEIRIYUHMPQTD-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|