C21H22N6O5 — CID 166425489
3-amino-N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-1-methylpyrazole-4-carboxamide (PubChem CID 166425489) has the molecular formula C21H22N6O5 and a molecular weight of 438.44 g/mol. Its IUPAC name is 3-amino-N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | 3-amino-N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166425489 |
| Molecular Formula | C21H22N6O5 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 3-amino-N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NCCCc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)c(N)n1 |
| InChI | InChI=1S/C21H22N6O5/c1-26-10-14(17(22)25-26)18(29)23-8-2-3-11-4-5-12-13(9-11)21(32)27(20(12)31)15-6-7-16(28)24-19(15)30/h4-5,9-10,15H,2-3,6-8H2,1H3,(H2,22,25)(H,23,29)(H,24,28,30) |
| InChIKey | XCCWOMRWAXDOMU-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 156.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|