C26H22N4O6 — CID 166427269
N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-N'-(3-ethynylphenyl)oxamide (PubChem CID 166427269) has the molecular formula C26H22N4O6 and a molecular weight of 486.48 g/mol. Its IUPAC name is N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-N'-(3-ethynylphenyl)oxamide.
| Compound Name | N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-N'-(3-ethynylphenyl)oxamide |
|---|---|
| PubChem CID | 166427269 |
| Molecular Formula | C26H22N4O6 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | N-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]propyl]-N'-(3-ethynylphenyl)oxamide |
| SMILES | C#Cc1cccc(NC(=O)C(=O)NCCCc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)c1 |
| InChI | InChI=1S/C26H22N4O6/c1-2-15-5-3-7-17(13-15)28-24(34)23(33)27-12-4-6-16-8-9-18-19(14-16)26(36)30(25(18)35)20-10-11-21(31)29-22(20)32/h1,3,5,7-9,13-14,20H,4,6,10-12H2,(H,27,33)(H,28,34)(H,29,31,32) |
| InChIKey | NYTPHRWAWYBCBK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|