C21H17ClN4O4S — CID 24788631
1-(4-chlorophenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]thiourea (PubChem CID 24788631) has the molecular formula C21H17ClN4O4S and a molecular weight of 456.91 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]thiourea |
|---|---|
| PubChem CID | 24788631 |
| Molecular Formula | C21H17ClN4O4S |
| Molecular Weight | 456.91 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]thiourea |
| SMILES | O=C1CCC(N2C(=O)c3ccc(CNC(=S)Nc4ccc(Cl)cc4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H17ClN4O4S/c22-12-2-4-13(5-3-12)24-21(31)23-10-11-1-6-14-15(9-11)20(30)26(19(14)29)16-7-8-17(27)25-18(16)28/h1-6,9,16H,7-8,10H2,(H2,23,24,31)(H,25,27,28) |
| InChIKey | HXUXAMBYFPRVRT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.91 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|