C18H20N4O4 — CID 167717864
2-(2,6-dioxopiperidin-3-yl)-5-[[[(3R)-pyrrolidin-3-yl]amino]methyl]isoindole-1,3-dione (PubChem CID 167717864) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[[[(3R)-pyrrolidin-3-yl]amino]methyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[[[(3R)-pyrrolidin-3-yl]amino]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167717864 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[[[(3R)-pyrrolidin-3-yl]amino]methyl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(CN[C@@H]4CCNC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C18H20N4O4/c23-15-4-3-14(16(24)21-15)22-17(25)12-2-1-10(7-13(12)18(22)26)8-20-11-5-6-19-9-11/h1-2,7,11,14,19-20H,3-6,8-9H2,(H,21,23,24)/t11-,14?/m1/s1 |
| InChIKey | UAWZGDKTUVKDBC-YNODCEANSA-N |
| XLogP | -0.46 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|