C19H20N4O4 — CID 167716886
5-[[[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167716886) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 5-[[[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167716886 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 5-[[[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(CNC4[C@H]5CNC[C@@H]45)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H20N4O4/c24-15-4-3-14(17(25)22-15)23-18(26)10-2-1-9(5-11(10)19(23)27)6-21-16-12-7-20-8-13(12)16/h1-2,5,12-14,16,20-21H,3-4,6-8H2,(H,22,24,25)/t12-,13+,14?,16? |
| InChIKey | QQMNZIYJDQFYRJ-KKNUOHPOSA-N |
| XLogP | -0.60 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|