C22H26N4O5 — CID 167734423
5-[[[(1S,5R)-7-amino-3-oxabicyclo[3.3.1]nonan-9-yl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167734423) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is 5-[[[(1S,5R)-7-amino-3-oxabicyclo[3.3.1]nonan-9-yl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[[(1S,5R)-7-amino-3-oxabicyclo[3.3.1]nonan-9-yl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167734423 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 5-[[[(1S,5R)-7-amino-3-oxabicyclo[3.3.1]nonan-9-yl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | NC1C[C@H]2COC[C@@H](C1)C2NCc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C22H26N4O5/c23-14-6-12-9-31-10-13(7-14)19(12)24-8-11-1-2-15-16(5-11)22(30)26(21(15)29)17-3-4-18(27)25-20(17)28/h1-2,5,12-14,17,19,24H,3-4,6-10,23H2,(H,25,27,28)/t12-,13+,14?,17?,19? |
| InChIKey | RPKIPUXOPSCQQJ-WPWIGGCWSA-N |
| XLogP | -0.07 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|