C30H32N4O5 — CID 172860045
3-[7-[4-[(2R)-1-(4-amino-3-methoxybenzoyl)piperidin-2-yl]but-1-ynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 172860045) has the molecular formula C30H32N4O5 and a molecular weight of 528.61 g/mol. Its IUPAC name is 3-[7-[4-[(2R)-1-(4-amino-3-methoxybenzoyl)piperidin-2-yl]but-1-ynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[4-[(2R)-1-(4-amino-3-methoxybenzoyl)piperidin-2-yl]but-1-ynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 172860045 |
| Molecular Formula | C30H32N4O5 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 3-[7-[4-[(2R)-1-(4-amino-3-methoxybenzoyl)piperidin-2-yl]but-1-ynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COc1cc(C(=O)N2CCCC[C@@H]2CCC#Cc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)ccc1N |
| InChI | InChI=1S/C30H32N4O5/c1-39-26-17-20(12-13-24(26)31)29(37)33-16-5-4-10-21(33)9-3-2-7-19-8-6-11-22-23(19)18-34(30(22)38)25-14-15-27(35)32-28(25)36/h6,8,11-13,17,21,25H,3-5,9-10,14-16,18,31H2,1H3,(H,32,35,36)/t21-,25?/m0/s1 |
| InChIKey | ZFNINCCOIBHDOI-BWDMCYIDSA-N |
| XLogP | 2.87 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|