C32H37N7O5 — CID 156882605
3-[7-[4-[3-[3-[4-(4-amino-3-methoxyphenyl)triazol-1-yl]propoxy]propylamino]but-1-ynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 156882605) has the molecular formula C32H37N7O5 and a molecular weight of 599.69 g/mol. Its IUPAC name is 3-[7-[4-[3-[3-[4-(4-amino-3-methoxyphenyl)triazol-1-yl]propoxy]propylamino]but-1-ynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[4-[3-[3-[4-(4-amino-3-methoxyphenyl)triazol-1-yl]propoxy]propylamino]but-1-ynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156882605 |
| Molecular Formula | C32H37N7O5 |
| Molecular Weight | 599.69 g/mol |
| Exact Mass | 599.29 |
| IUPAC Name | 3-[7-[4-[3-[3-[4-(4-amino-3-methoxyphenyl)triazol-1-yl]propoxy]propylamino]but-1-ynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COc1cc(-c2cn(CCCOCCCNCCC#Cc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)nn2)ccc1N |
| InChI | InChI=1S/C32H37N7O5/c1-43-29-19-23(10-11-26(29)33)27-21-38(37-36-27)16-6-18-44-17-5-15-34-14-3-2-7-22-8-4-9-24-25(22)20-39(32(24)42)28-12-13-30(40)35-31(28)41/h4,8-11,19,21,28,34H,3,5-6,12-18,20,33H2,1H3,(H,35,40,41) |
| InChIKey | CZKJTZCNPSRJQQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 153.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.69 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|