C20H19BN3O4 — CID 145384649
CID 145384649 (PubChem CID 145384649) has the molecular formula C20H19BN3O4 and a molecular weight of 376.20 g/mol.
| Compound Name | CID 145384649 |
|---|---|
| PubChem CID | 145384649 |
| Molecular Formula | C20H19BN3O4 |
| Molecular Weight | 376.20 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | — |
| SMILES | [B]=C1CN1CCOCC#Cc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C20H19BN3O4/c21-17-12-23(17)8-10-28-9-2-4-13-3-1-5-14-15(13)11-24(20(14)27)16-6-7-18(25)22-19(16)26/h1,3,5,16H,6-12H2,(H,22,25,26) |
| InChIKey | FBEHGOPZSIAQAG-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.20 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|