C23H26N4O6 — CID 172602315
3-[6-[(hydroxyamino)methyl]-7-[[2-methoxy-4-(methylamino)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 172602315) has the molecular formula C23H26N4O6 and a molecular weight of 454.48 g/mol. Its IUPAC name is 3-[6-[(hydroxyamino)methyl]-7-[[2-methoxy-4-(methylamino)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(hydroxyamino)methyl]-7-[[2-methoxy-4-(methylamino)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 172602315 |
| Molecular Formula | C23H26N4O6 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 3-[6-[(hydroxyamino)methyl]-7-[[2-methoxy-4-(methylamino)phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CNc1ccc(COc2c(CNO)ccc3c2CN(C2CCC(=O)NC2=O)C3=O)c(OC)c1 |
| InChI | InChI=1S/C23H26N4O6/c1-24-15-5-3-14(19(9-15)32-2)12-33-21-13(10-25-31)4-6-16-17(21)11-27(23(16)30)18-7-8-20(28)26-22(18)29/h3-6,9,18,24-25,31H,7-8,10-12H2,1-2H3,(H,26,28,29) |
| InChIKey | LBLGVJBWMWIFGO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|