C28H26N4O6 — CID 166074291
[2-(2,6-dioxopiperidin-3-yl)-7-methoxy-3-oxo-1H-isoindol-5-yl]methyl N-(5-methyl-6-phenyl-3-pyridinyl)carbamate (PubChem CID 166074291) has the molecular formula C28H26N4O6 and a molecular weight of 514.54 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-7-methoxy-3-oxo-1H-isoindol-5-yl]methyl N-(5-methyl-6-phenyl-3-pyridinyl)carbamate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-7-methoxy-3-oxo-1H-isoindol-5-yl]methyl N-(5-methyl-6-phenyl-3-pyridinyl)carbamate |
|---|---|
| PubChem CID | 166074291 |
| Molecular Formula | C28H26N4O6 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-7-methoxy-3-oxo-1H-isoindol-5-yl]methyl N-(5-methyl-6-phenyl-3-pyridinyl)carbamate |
| SMILES | COc1cc(COC(=O)Nc2cnc(-c3ccccc3)c(C)c2)cc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C28H26N4O6/c1-16-10-19(13-29-25(16)18-6-4-3-5-7-18)30-28(36)38-15-17-11-20-21(23(12-17)37-2)14-32(27(20)35)22-8-9-24(33)31-26(22)34/h3-7,10-13,22H,8-9,14-15H2,1-2H3,(H,30,36)(H,31,33,34) |
| InChIKey | CJPOCWXKYPARLC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|