C25H26FN3O5 — CID 166074333
[2-(2,6-dioxopiperidin-3-yl)-7-fluoro-3-oxo-1H-isoindol-5-yl]methyl N-(3-tert-butylphenyl)carbamate (PubChem CID 166074333) has the molecular formula C25H26FN3O5 and a molecular weight of 467.50 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-7-fluoro-3-oxo-1H-isoindol-5-yl]methyl N-(3-tert-butylphenyl)carbamate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-7-fluoro-3-oxo-1H-isoindol-5-yl]methyl N-(3-tert-butylphenyl)carbamate |
|---|---|
| PubChem CID | 166074333 |
| Molecular Formula | C25H26FN3O5 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-7-fluoro-3-oxo-1H-isoindol-5-yl]methyl N-(3-tert-butylphenyl)carbamate |
| SMILES | CC(C)(C)c1cccc(NC(=O)OCc2cc(F)c3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)c1 |
| InChI | InChI=1S/C25H26FN3O5/c1-25(2,3)15-5-4-6-16(11-15)27-24(33)34-13-14-9-17-18(19(26)10-14)12-29(23(17)32)20-7-8-21(30)28-22(20)31/h4-6,9-11,20H,7-8,12-13H2,1-3H3,(H,27,33)(H,28,30,31) |
| InChIKey | XHHBJSVOGFLJIL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|