C28H36FN3O3 — CID 169067856
3-[6-[[(1R,2S)-2-(1,2,3,3a,4,5,6,6a-octahydropentalen-2-ylamino)cyclohexyl]methyl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169067856) has the molecular formula C28H36FN3O3 and a molecular weight of 481.61 g/mol. Its IUPAC name is 3-[6-[[(1R,2S)-2-(1,2,3,3a,4,5,6,6a-octahydropentalen-2-ylamino)cyclohexyl]methyl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[(1R,2S)-2-(1,2,3,3a,4,5,6,6a-octahydropentalen-2-ylamino)cyclohexyl]methyl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169067856 |
| Molecular Formula | C28H36FN3O3 |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | 3-[6-[[(1R,2S)-2-(1,2,3,3a,4,5,6,6a-octahydropentalen-2-ylamino)cyclohexyl]methyl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(ccc(C[C@H]4CCCC[C@@H]4NC4CC5CCCC5C4)c3F)C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H36FN3O3/c29-26-19(8-9-21-22(26)15-32(28(21)35)24-10-11-25(33)31-27(24)34)12-18-4-1-2-7-23(18)30-20-13-16-5-3-6-17(16)14-20/h8-9,16-18,20,23-24,30H,1-7,10-15H2,(H,31,33,34)/t16?,17?,18-,20?,23+,24?/m1/s1 |
| InChIKey | XDTPIFMNSVCVKE-KJEVGKFHSA-N |
| XLogP | 3.86 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|